C11H16FN3 — CID 115417181
N-(2,2-dimethylcyclopentyl)-6-fluoropyrimidin-4-amine (PubChem CID 115417181) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopentyl)-6-fluoropyrimidin-4-amine.
| Compound Name | N-(2,2-dimethylcyclopentyl)-6-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 115417181 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | N-(2,2-dimethylcyclopentyl)-6-fluoropyrimidin-4-amine |
| SMILES | CC1(C)CCCC1Nc1cc(F)ncn1 |
| InChI | InChI=1S/C11H16FN3/c1-11(2)5-3-4-8(11)15-10-6-9(12)13-7-14-10/h6-8H,3-5H2,1-2H3,(H,13,14,15) |
| InChIKey | IBNQAYHFQFWCRE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |