C18H27NO2 — CID 115417710
3,10-dimethyl-N-propyl-3,4,7,8,9,10-hexahydro-2H-benzo[h][1,5]benzodioxepin-7-amine (PubChem CID 115417710) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3,10-dimethyl-N-propyl-3,4,7,8,9,10-hexahydro-2H-benzo[h][1,5]benzodioxepin-7-amine.
| Compound Name | 3,10-dimethyl-N-propyl-3,4,7,8,9,10-hexahydro-2H-benzo[h][1,5]benzodioxepin-7-amine |
|---|---|
| PubChem CID | 115417710 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3,10-dimethyl-N-propyl-3,4,7,8,9,10-hexahydro-2H-benzo[h][1,5]benzodioxepin-7-amine |
| SMILES | CCCNC1CCC(C)c2cc3c(cc21)OCC(C)CO3 |
| InChI | InChI=1S/C18H27NO2/c1-4-7-19-16-6-5-13(3)14-8-17-18(9-15(14)16)21-11-12(2)10-20-17/h8-9,12-13,16,19H,4-7,10-11H2,1-3H3 |
| InChIKey | NCHHNYMKNMKVCT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |