C13H16ClF — CID 115418057
4-chloro-6-fluoro-1,5,7-trimethyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 115418057) has the molecular formula C13H16ClF and a molecular weight of 226.72 g/mol. Its IUPAC name is 4-chloro-6-fluoro-1,5,7-trimethyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 4-chloro-6-fluoro-1,5,7-trimethyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 115418057 |
| Molecular Formula | C13H16ClF |
| Molecular Weight | 226.72 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 4-chloro-6-fluoro-1,5,7-trimethyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1cc2c(c(C)c1F)C(Cl)CCC2C |
| InChI | InChI=1S/C13H16ClF/c1-7-4-5-11(14)12-9(3)13(15)8(2)6-10(7)12/h6-7,11H,4-5H2,1-3H3 |
| InChIKey | LRTXKBCRYVNHAY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|