C13H17Cl — CID 115483289
1-chloro-3,3,5,6-tetramethyl-1,2-dihydroindene (PubChem CID 115483289) has the molecular formula C13H17Cl and a molecular weight of 208.73 g/mol. Its IUPAC name is 1-chloro-3,3,5,6-tetramethyl-1,2-dihydroindene.
| Compound Name | 1-chloro-3,3,5,6-tetramethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 115483289 |
| Molecular Formula | C13H17Cl |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-chloro-3,3,5,6-tetramethyl-1,2-dihydroindene |
| SMILES | Cc1cc2c(cc1C)C(C)(C)CC2Cl |
| InChI | InChI=1S/C13H17Cl/c1-8-5-10-11(6-9(8)2)13(3,4)7-12(10)14/h5-6,12H,7H2,1-4H3 |
| InChIKey | BVTOQSDRLMDXRV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|