C13H16ClF — CID 131048394
1-chloro-6-fluoro-3,3,4,7-tetramethyl-1,2-dihydroindene (PubChem CID 131048394) has the molecular formula C13H16ClF and a molecular weight of 226.72 g/mol. Its IUPAC name is 1-chloro-6-fluoro-3,3,4,7-tetramethyl-1,2-dihydroindene.
| Compound Name | 1-chloro-6-fluoro-3,3,4,7-tetramethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 131048394 |
| Molecular Formula | C13H16ClF |
| Molecular Weight | 226.72 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-chloro-6-fluoro-3,3,4,7-tetramethyl-1,2-dihydroindene |
| SMILES | Cc1cc(F)c(C)c2c1C(C)(C)CC2Cl |
| InChI | InChI=1S/C13H16ClF/c1-7-5-10(15)8(2)11-9(14)6-13(3,4)12(7)11/h5,9H,6H2,1-4H3 |
| InChIKey | JWASEQKBYBZZIF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|