C13H18O2 — CID 142958828
1,4,4,7-tetramethyl-1,3-dihydroisochromen-6-ol (PubChem CID 142958828) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1,4,4,7-tetramethyl-1,3-dihydroisochromen-6-ol.
| Compound Name | 1,4,4,7-tetramethyl-1,3-dihydroisochromen-6-ol |
|---|---|
| PubChem CID | 142958828 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1,4,4,7-tetramethyl-1,3-dihydroisochromen-6-ol |
| SMILES | Cc1cc2c(cc1O)C(C)(C)COC2C |
| InChI | InChI=1S/C13H18O2/c1-8-5-10-9(2)15-7-13(3,4)11(10)6-12(8)14/h5-6,9,14H,7H2,1-4H3 |
| InChIKey | MBLPWUDMJYYASW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |