C15H22O2 — CID 11356756
2-methyl-5-(1,2,2-trimethylcyclopentyl)benzene-1,4-diol (PubChem CID 11356756) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-methyl-5-(1,2,2-trimethylcyclopentyl)benzene-1,4-diol.
| Compound Name | 2-methyl-5-(1,2,2-trimethylcyclopentyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 11356756 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-methyl-5-(1,2,2-trimethylcyclopentyl)benzene-1,4-diol |
| SMILES | Cc1cc(O)c(C2(C)CCCC2(C)C)cc1O |
| InChI | InChI=1S/C15H22O2/c1-10-8-13(17)11(9-12(10)16)15(4)7-5-6-14(15,2)3/h8-9,16-17H,5-7H2,1-4H3 |
| InChIKey | GDVVPXPJALHXQC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|