C21H24O2 — CID 54557003
2,2',6,6'-tetramethylspiro[1,2-dihydroindene-3,1'-2,3-dihydroindene]-5,5'-diol (PubChem CID 54557003) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2,2',6,6'-tetramethylspiro[1,2-dihydroindene-3,1'-2,3-dihydroindene]-5,5'-diol.
| Compound Name | 2,2',6,6'-tetramethylspiro[1,2-dihydroindene-3,1'-2,3-dihydroindene]-5,5'-diol |
|---|---|
| PubChem CID | 54557003 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2,2',6,6'-tetramethylspiro[1,2-dihydroindene-3,1'-2,3-dihydroindene]-5,5'-diol |
| SMILES | Cc1cc2c(cc1O)CC(C)C21c2cc(O)c(C)cc2CC1C |
| InChI | InChI=1S/C21H24O2/c1-11-5-15-7-13(3)21(18(15)10-20(11)23)14(4)8-16-9-19(22)12(2)6-17(16)21/h5-6,9-10,13-14,22-23H,7-8H2,1-4H3 |
| InChIKey | ZNWINWXGZHQTIV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |