C14H19N3O3 — CID 115425538
6-amino-5-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 115425538) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 6-amino-5-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115425538 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 6-amino-5-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1N1CCCC1CCCO |
| InChI | InChI=1S/C14H19N3O3/c15-10-7-13-11(16-14(19)20-13)8-12(10)17-5-1-3-9(17)4-2-6-18/h7-9,18H,1-6,15H2,(H,16,19) |
| InChIKey | BTCVGHSTDPTOFI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|