C14H17N3O2 — CID 115558920
5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-amino-3H-1,3-benzoxazol-2-one (PubChem CID 115558920) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-amino-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-amino-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115558920 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-amino-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1N1CC2CCCC2C1 |
| InChI | InChI=1S/C14H17N3O2/c15-10-4-13-11(16-14(18)19-13)5-12(10)17-6-8-2-1-3-9(8)7-17/h4-5,8-9H,1-3,6-7,15H2,(H,16,18) |
| InChIKey | SQIIQHXQDMTRCV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|