C12H15N3O3 — CID 115425570
6-amino-5-(1,4-oxazepan-4-yl)-3H-1,3-benzoxazol-2-one (PubChem CID 115425570) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 6-amino-5-(1,4-oxazepan-4-yl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-(1,4-oxazepan-4-yl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115425570 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 6-amino-5-(1,4-oxazepan-4-yl)-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1N1CCCOCC1 |
| InChI | InChI=1S/C12H15N3O3/c13-8-6-11-9(14-12(16)18-11)7-10(8)15-2-1-4-17-5-3-15/h6-7H,1-5,13H2,(H,14,16) |
| InChIKey | KUYDADZBNWMQBQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|