C13H15N3O2 — CID 113307400
6-amino-5-(2-azabicyclo[2.2.1]heptan-2-yl)-3H-1,3-benzoxazol-2-one (PubChem CID 113307400) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 6-amino-5-(2-azabicyclo[2.2.1]heptan-2-yl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-(2-azabicyclo[2.2.1]heptan-2-yl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 113307400 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 6-amino-5-(2-azabicyclo[2.2.1]heptan-2-yl)-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1N1CC2CCC1C2 |
| InChI | InChI=1S/C13H15N3O2/c14-9-4-12-10(15-13(17)18-12)5-11(9)16-6-7-1-2-8(16)3-7/h4-5,7-8H,1-3,6,14H2,(H,15,17) |
| InChIKey | AAHKTOOQUIUFCA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|