C10H16O3 — CID 11542886
(3aS,4S,6R,6aR)-4-ethenyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 11542886) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (3aS,4S,6R,6aR)-4-ethenyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4S,6R,6aR)-4-ethenyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 11542886 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (3aS,4S,6R,6aR)-4-ethenyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | C=C[C@@H]1O[C@H](C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C10H16O3/c1-5-7-9-8(6(2)11-7)12-10(3,4)13-9/h5-9H,1H2,2-4H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | WGKDFQXQMUQWLO-XAVMHZPKSA-N |
| XLogP | 1.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|