C23H44O2Sn — CID 139249348
tributyl-[(E)-4-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-1-enyl]stannane (PubChem CID 139249348) has the molecular formula C23H44O2Sn and a molecular weight of 471.31 g/mol. Its IUPAC name is tributyl-[(E)-4-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-1-enyl]stannane.
| Compound Name | tributyl-[(E)-4-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-1-enyl]stannane |
|---|---|
| PubChem CID | 139249348 |
| Molecular Formula | C23H44O2Sn |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | tributyl-[(E)-4-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-1-enyl]stannane |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H]1CC/C=C/[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C11H17O2.3C4H9.Sn/c1-5-7-8-10-9(6-2)12-11(3,4)13-10;3*1-3-4-2;/h1,5-6,9-10H,2,7-8H2,3-4H3;3*1,3-4H2,2H3;/t9-,10+;;;;/m1..../s1 |
| InChIKey | NMDLSPSYIONGAJ-OOFBUDRMSA-N |
| XLogP | 7.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|