C15H23N3O3 — CID 115430878
2-ethyl-2-[[[methyl(pyridin-2-ylmethyl)carbamoyl]amino]methyl]butanoic acid (PubChem CID 115430878) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-ethyl-2-[[[methyl(pyridin-2-ylmethyl)carbamoyl]amino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[[methyl(pyridin-2-ylmethyl)carbamoyl]amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 115430878 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-ethyl-2-[[[methyl(pyridin-2-ylmethyl)carbamoyl]amino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNC(=O)N(C)Cc1ccccn1)C(=O)O |
| InChI | InChI=1S/C15H23N3O3/c1-4-15(5-2,13(19)20)11-17-14(21)18(3)10-12-8-6-7-9-16-12/h6-9H,4-5,10-11H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | UNDSSMNOUCSBQF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |