C15H26N4O2 — CID 115431503
2-[[5-(2-cyclopentylethyl)tetrazol-1-yl]methyl]-2-ethylbutanoic acid (PubChem CID 115431503) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-[[5-(2-cyclopentylethyl)tetrazol-1-yl]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[5-(2-cyclopentylethyl)tetrazol-1-yl]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 115431503 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-[[5-(2-cyclopentylethyl)tetrazol-1-yl]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(Cn1nnnc1CCC1CCCC1)C(=O)O |
| InChI | InChI=1S/C15H26N4O2/c1-3-15(4-2,14(20)21)11-19-13(16-17-18-19)10-9-12-7-5-6-8-12/h12H,3-11H2,1-2H3,(H,20,21) |
| InChIKey | KOXVRIKPNHBSCR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |