C13H18N4O2S — CID 115431506
2-ethyl-2-[[5-(3-methylthiophen-2-yl)tetrazol-1-yl]methyl]butanoic acid (PubChem CID 115431506) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-ethyl-2-[[5-(3-methylthiophen-2-yl)tetrazol-1-yl]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[5-(3-methylthiophen-2-yl)tetrazol-1-yl]methyl]butanoic acid |
|---|---|
| PubChem CID | 115431506 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-ethyl-2-[[5-(3-methylthiophen-2-yl)tetrazol-1-yl]methyl]butanoic acid |
| SMILES | CCC(CC)(Cn1nnnc1-c1sccc1C)C(=O)O |
| InChI | InChI=1S/C13H18N4O2S/c1-4-13(5-2,12(18)19)8-17-11(14-15-16-17)10-9(3)6-7-20-10/h6-7H,4-5,8H2,1-3H3,(H,18,19) |
| InChIKey | DWADPFSZLKFDQT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |