C13H16Cl2N4OS — CID 115431859
2-(aminomethyl)-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-ethylbutanamide (PubChem CID 115431859) has the molecular formula C13H16Cl2N4OS and a molecular weight of 347.27 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-ethylbutanamide.
| Compound Name | 2-(aminomethyl)-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-ethylbutanamide |
|---|---|
| PubChem CID | 115431859 |
| Molecular Formula | C13H16Cl2N4OS |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-(aminomethyl)-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-ethylbutanamide |
| SMILES | CCC(CC)(CN)C(=O)Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C13H16Cl2N4OS/c1-3-13(4-2,6-16)12(20)17-9-7(14)5-8(15)10-11(9)19-21-18-10/h5H,3-4,6,16H2,1-2H3,(H,17,20) |
| InChIKey | JSKPEUJFNYAWBF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |