C12H14Cl2N4OS — CID 81075951
3-(aminomethyl)-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)pentanamide (PubChem CID 81075951) has the molecular formula C12H14Cl2N4OS and a molecular weight of 333.24 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)pentanamide.
| Compound Name | 3-(aminomethyl)-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)pentanamide |
|---|---|
| PubChem CID | 81075951 |
| Molecular Formula | C12H14Cl2N4OS |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 3-(aminomethyl)-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)pentanamide |
| SMILES | CCC(CN)CC(=O)Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C12H14Cl2N4OS/c1-2-6(5-15)3-9(19)16-10-7(13)4-8(14)11-12(10)18-20-17-11/h4,6H,2-3,5,15H2,1H3,(H,16,19) |
| InChIKey | LCORLVZYAIXTRX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |