C11H12Cl2N4O2S — CID 103154758
4-amino-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3-methoxybutanamide (PubChem CID 103154758) has the molecular formula C11H12Cl2N4O2S and a molecular weight of 335.22 g/mol. Its IUPAC name is 4-amino-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3-methoxybutanamide.
| Compound Name | 4-amino-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3-methoxybutanamide |
|---|---|
| PubChem CID | 103154758 |
| Molecular Formula | C11H12Cl2N4O2S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 4-amino-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3-methoxybutanamide |
| SMILES | COC(CN)CC(=O)Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C11H12Cl2N4O2S/c1-19-5(4-14)2-8(18)15-9-6(12)3-7(13)10-11(9)17-20-16-10/h3,5H,2,4,14H2,1H3,(H,15,18) |
| InChIKey | AGWWAGIZGHDKNG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |