C15H12Cl2O2 — CID 11543891
(1S,12R)-4,10-dichloro-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one (PubChem CID 11543891) has the molecular formula C15H12Cl2O2 and a molecular weight of 295.16 g/mol. Its IUPAC name is (1S,12R)-4,10-dichloro-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one.
| Compound Name | (1S,12R)-4,10-dichloro-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one |
|---|---|
| PubChem CID | 11543891 |
| Molecular Formula | C15H12Cl2O2 |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | (1S,12R)-4,10-dichloro-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one |
| SMILES | O=C1C(Cl)=C2c3ccc(O)c(Cl)c3C[C@@]23CC[C@@H]1C3 |
| InChI | InChI=1S/C15H12Cl2O2/c16-12-9-6-15-4-3-7(5-15)14(19)13(17)11(15)8(9)1-2-10(12)18/h1-2,7,18H,3-6H2/t7-,15+/m1/s1 |
| InChIKey | FWXBWNUVKXIRJE-MLXNANBUSA-N |
| XLogP | 3.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|