C19H19BrClFO2 — CID 10273183
4-bromo-8-chloro-9a-(cyclopentylmethyl)-6-fluoro-7-hydroxy-2,9-dihydro-1H-fluoren-3-one (PubChem CID 10273183) has the molecular formula C19H19BrClFO2 and a molecular weight of 413.71 g/mol. Its IUPAC name is 4-bromo-8-chloro-9a-(cyclopentylmethyl)-6-fluoro-7-hydroxy-2,9-dihydro-1H-fluoren-3-one.
| Compound Name | 4-bromo-8-chloro-9a-(cyclopentylmethyl)-6-fluoro-7-hydroxy-2,9-dihydro-1H-fluoren-3-one |
|---|---|
| PubChem CID | 10273183 |
| Molecular Formula | C19H19BrClFO2 |
| Molecular Weight | 413.71 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 4-bromo-8-chloro-9a-(cyclopentylmethyl)-6-fluoro-7-hydroxy-2,9-dihydro-1H-fluoren-3-one |
| SMILES | O=C1CCC2(CC3CCCC3)Cc3c(cc(F)c(O)c3Cl)C2=C1Br |
| InChI | InChI=1S/C19H19BrClFO2/c20-16-14(23)5-6-19(8-10-3-1-2-4-10)9-12-11(15(16)19)7-13(22)18(24)17(12)21/h7,10,24H,1-6,8-9H2 |
| InChIKey | WGECRQXMDUWPSA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.71 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|