C17H17BrClFO2 — CID 10091641
1-bromo-3a-butyl-6-chloro-8-fluoro-7-hydroxy-4,5-dihydro-3H-cyclopenta[a]naphthalen-2-one (PubChem CID 10091641) has the molecular formula C17H17BrClFO2 and a molecular weight of 387.68 g/mol. Its IUPAC name is 1-bromo-3a-butyl-6-chloro-8-fluoro-7-hydroxy-4,5-dihydro-3H-cyclopenta[a]naphthalen-2-one.
| Compound Name | 1-bromo-3a-butyl-6-chloro-8-fluoro-7-hydroxy-4,5-dihydro-3H-cyclopenta[a]naphthalen-2-one |
|---|---|
| PubChem CID | 10091641 |
| Molecular Formula | C17H17BrClFO2 |
| Molecular Weight | 387.68 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 1-bromo-3a-butyl-6-chloro-8-fluoro-7-hydroxy-4,5-dihydro-3H-cyclopenta[a]naphthalen-2-one |
| SMILES | CCCCC12CCc3c(cc(F)c(O)c3Cl)C1=C(Br)C(=O)C2 |
| InChI | InChI=1S/C17H17BrClFO2/c1-2-3-5-17-6-4-9-10(7-11(20)16(22)15(9)19)13(17)14(18)12(21)8-17/h7,22H,2-6,8H2,1H3 |
| InChIKey | GEGRTGUVVLOGBT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|