C15H21N3O3 — CID 115441131
1-[[(5-carbamoyl-2-pyridinyl)amino]methyl]-4-methylcyclohexane-1-carboxylic acid (PubChem CID 115441131) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[[(5-carbamoyl-2-pyridinyl)amino]methyl]-4-methylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(5-carbamoyl-2-pyridinyl)amino]methyl]-4-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 115441131 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[[(5-carbamoyl-2-pyridinyl)amino]methyl]-4-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(CNc2ccc(C(N)=O)cn2)(C(=O)O)CC1 |
| InChI | InChI=1S/C15H21N3O3/c1-10-4-6-15(7-5-10,14(20)21)9-18-12-3-2-11(8-17-12)13(16)19/h2-3,8,10H,4-7,9H2,1H3,(H2,16,19)(H,17,18)(H,20,21) |
| InChIKey | KKWDZUQBCJAZMU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |