C12H14N2O6S — CID 115450275
1-[[(4-nitrophenyl)methylsulfonylamino]methyl]cyclopropane-1-carboxylic acid (PubChem CID 115450275) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is 1-[[(4-nitrophenyl)methylsulfonylamino]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[(4-nitrophenyl)methylsulfonylamino]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 115450275 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-[[(4-nitrophenyl)methylsulfonylamino]methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNS(=O)(=O)Cc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C12H14N2O6S/c15-11(16)12(5-6-12)8-13-21(19,20)7-9-1-3-10(4-2-9)14(17)18/h1-4,13H,5-8H2,(H,15,16) |
| InChIKey | CFLLZWHLNIULSS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|