C11H10Cl2N2O5S — CID 78895563
2,2-dichloro-N-[(4-nitrophenyl)methylsulfonyl]cyclopropane-1-carboxamide (PubChem CID 78895563) has the molecular formula C11H10Cl2N2O5S and a molecular weight of 353.18 g/mol. Its IUPAC name is 2,2-dichloro-N-[(4-nitrophenyl)methylsulfonyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[(4-nitrophenyl)methylsulfonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78895563 |
| Molecular Formula | C11H10Cl2N2O5S |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 2,2-dichloro-N-[(4-nitrophenyl)methylsulfonyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1)C1CC1(Cl)Cl |
| InChI | InChI=1S/C11H10Cl2N2O5S/c12-11(13)5-9(11)10(16)14-21(19,20)6-7-1-3-8(4-2-7)15(17)18/h1-4,9H,5-6H2,(H,14,16) |
| InChIKey | ODJZEBJCDJJRHE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|