C14H10F2N2O5S — CID 55757836
3,4-difluoro-N-[(4-nitrophenyl)methylsulfonyl]benzamide (PubChem CID 55757836) has the molecular formula C14H10F2N2O5S and a molecular weight of 356.31 g/mol. Its IUPAC name is 3,4-difluoro-N-[(4-nitrophenyl)methylsulfonyl]benzamide.
| Compound Name | 3,4-difluoro-N-[(4-nitrophenyl)methylsulfonyl]benzamide |
|---|---|
| PubChem CID | 55757836 |
| Molecular Formula | C14H10F2N2O5S |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 3,4-difluoro-N-[(4-nitrophenyl)methylsulfonyl]benzamide |
| SMILES | O=C(NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H10F2N2O5S/c15-12-6-3-10(7-13(12)16)14(19)17-24(22,23)8-9-1-4-11(5-2-9)18(20)21/h1-7H,8H2,(H,17,19) |
| InChIKey | BXYMAKZQRLCLJD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|