C8H12ClN3S — CID 115455734
N-[[1-(chloromethyl)cyclopropyl]methyl]-5-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 115455734) has the molecular formula C8H12ClN3S and a molecular weight of 217.72 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclopropyl]methyl]-5-methyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-5-methyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 115455734 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-5-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nnc(NCC2(CCl)CC2)s1 |
| InChI | InChI=1S/C8H12ClN3S/c1-6-11-12-7(13-6)10-5-8(4-9)2-3-8/h2-5H2,1H3,(H,10,12) |
| InChIKey | RBNFHPBUZCRBFN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|