C9H12N4O3 — CID 115457363
2-[4-[[[(E)-but-2-enoyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 115457363) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-[4-[[[(E)-but-2-enoyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[(E)-but-2-enoyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115457363 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-[4-[[[(E)-but-2-enoyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | C/C=C/C(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C9H12N4O3/c1-2-3-8(14)10-4-7-5-13(12-11-7)6-9(15)16/h2-3,5H,4,6H2,1H3,(H,10,14)(H,15,16)/b3-2+ |
| InChIKey | WVFGZVFFEAWHID-NSCUHMNNSA-N |
| XLogP | -0.44 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|