C14H20N6O5 — CID 162409354
2-(6,9,12-trioxo-1,7,10,13,16,17-hexazabicyclo[13.2.1]octadeca-15(18),16-dien-13-yl)acetic acid (PubChem CID 162409354) has the molecular formula C14H20N6O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is 2-(6,9,12-trioxo-1,7,10,13,16,17-hexazabicyclo[13.2.1]octadeca-15(18),16-dien-13-yl)acetic acid.
| Compound Name | 2-(6,9,12-trioxo-1,7,10,13,16,17-hexazabicyclo[13.2.1]octadeca-15(18),16-dien-13-yl)acetic acid |
|---|---|
| PubChem CID | 162409354 |
| Molecular Formula | C14H20N6O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-(6,9,12-trioxo-1,7,10,13,16,17-hexazabicyclo[13.2.1]octadeca-15(18),16-dien-13-yl)acetic acid |
| SMILES | O=C(O)CN1Cc2cn(nn2)CCCCC(=O)NCC(=O)NCC1=O |
| InChI | InChI=1S/C14H20N6O5/c21-11-3-1-2-4-20-8-10(17-18-20)7-19(9-14(24)25)13(23)6-16-12(22)5-15-11/h8H,1-7,9H2,(H,15,21)(H,16,22)(H,24,25) |
| InChIKey | UAHYZYASHAXSQP-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 146.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |