C18H19NO2 — CID 115462844
methyl 2-[2-(1,3-dihydroisoindol-2-ylmethyl)phenyl]acetate (PubChem CID 115462844) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is methyl 2-[2-(1,3-dihydroisoindol-2-ylmethyl)phenyl]acetate.
| Compound Name | methyl 2-[2-(1,3-dihydroisoindol-2-ylmethyl)phenyl]acetate |
|---|---|
| PubChem CID | 115462844 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | methyl 2-[2-(1,3-dihydroisoindol-2-ylmethyl)phenyl]acetate |
| SMILES | COC(=O)Cc1ccccc1CN1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H19NO2/c1-21-18(20)10-14-6-2-3-7-15(14)11-19-12-16-8-4-5-9-17(16)13-19/h2-9H,10-13H2,1H3 |
| InChIKey | KDLYTLXJGKTUOD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |