C16H17N3O — CID 63573353
2-(1,3-dihydroisoindol-2-ylmethyl)benzohydrazide (PubChem CID 63573353) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-(1,3-dihydroisoindol-2-ylmethyl)benzohydrazide.
| Compound Name | 2-(1,3-dihydroisoindol-2-ylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 63573353 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-(1,3-dihydroisoindol-2-ylmethyl)benzohydrazide |
| SMILES | NNC(=O)c1ccccc1CN1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H17N3O/c17-18-16(20)15-8-4-3-7-14(15)11-19-9-12-5-1-2-6-13(12)10-19/h1-8H,9-11,17H2,(H,18,20) |
| InChIKey | WXWZSELISVYFQD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|