C12H15N3O4S — CID 79886178
2-[(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)methyl]benzohydrazide (PubChem CID 79886178) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)methyl]benzohydrazide.
| Compound Name | 2-[(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 79886178 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-[(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)methyl]benzohydrazide |
| SMILES | CC1(C)C(=O)N(Cc2ccccc2C(=O)NN)S1(=O)=O |
| InChI | InChI=1S/C12H15N3O4S/c1-12(2)11(17)15(20(12,18)19)7-8-5-3-4-6-9(8)10(16)14-13/h3-6H,7,13H2,1-2H3,(H,14,16) |
| InChIKey | OGVFJUCZPGQKKR-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|