C14H10F3N3O — CID 115468338
4-[(6-amino-2-pyridinyl)methoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 115468338) has the molecular formula C14H10F3N3O and a molecular weight of 293.25 g/mol. Its IUPAC name is 4-[(6-amino-2-pyridinyl)methoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(6-amino-2-pyridinyl)methoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115468338 |
| Molecular Formula | C14H10F3N3O |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-[(6-amino-2-pyridinyl)methoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(OCc2cccc(N)n2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F3N3O/c15-14(16,17)11-6-9(7-18)4-5-12(11)21-8-10-2-1-3-13(19)20-10/h1-6H,8H2,(H2,19,20) |
| InChIKey | VMZMLNQLHHQNBN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |