C15H18F3NOS — CID 115468396
4-[3,3-dimethyl-2-(sulfanylmethyl)butoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 115468396) has the molecular formula C15H18F3NOS and a molecular weight of 317.38 g/mol. Its IUPAC name is 4-[3,3-dimethyl-2-(sulfanylmethyl)butoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3,3-dimethyl-2-(sulfanylmethyl)butoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115468396 |
| Molecular Formula | C15H18F3NOS |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-[3,3-dimethyl-2-(sulfanylmethyl)butoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)(C)C(CS)COc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C15H18F3NOS/c1-14(2,3)11(9-21)8-20-13-5-4-10(7-19)6-12(13)15(16,17)18/h4-6,11,21H,8-9H2,1-3H3 |
| InChIKey | HVCPWIULBNICSF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 33.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|