C14H14F3NOS — CID 115468398
4-[[1-(sulfanylmethyl)cyclobutyl]methoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 115468398) has the molecular formula C14H14F3NOS and a molecular weight of 301.33 g/mol. Its IUPAC name is 4-[[1-(sulfanylmethyl)cyclobutyl]methoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[1-(sulfanylmethyl)cyclobutyl]methoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115468398 |
| Molecular Formula | C14H14F3NOS |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-[[1-(sulfanylmethyl)cyclobutyl]methoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(OCC2(CS)CCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3NOS/c15-14(16,17)11-6-10(7-18)2-3-12(11)19-8-13(9-20)4-1-5-13/h2-3,6,20H,1,4-5,8-9H2 |
| InChIKey | CIPZTOFJZSLXRA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 33.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|