C15H22ClN3 — CID 115472958
N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2-methylpropan-1-amine (PubChem CID 115472958) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 115472958 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2-methylpropan-1-amine |
| SMILES | CCCn1c(CNCC(C)C)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H22ClN3/c1-4-7-19-14-8-12(16)5-6-13(14)18-15(19)10-17-9-11(2)3/h5-6,8,11,17H,4,7,9-10H2,1-3H3 |
| InChIKey | JEBWXAHSAUZAOG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |