C20H26ClN4OS+ — CID 87972565
(6-chloro-1-propylbenzimidazol-2-yl)methyl-formyl-(2-methylpropyl)-(2-methyl-1,3-thiazol-4-yl)azanium (PubChem CID 87972565) has the molecular formula C20H26ClN4OS+ and a molecular weight of 405.98 g/mol. Its IUPAC name is (6-chloro-1-propylbenzimidazol-2-yl)methyl-formyl-(2-methylpropyl)-(2-methyl-1,3-thiazol-4-yl)azanium.
| Compound Name | (6-chloro-1-propylbenzimidazol-2-yl)methyl-formyl-(2-methylpropyl)-(2-methyl-1,3-thiazol-4-yl)azanium |
|---|---|
| PubChem CID | 87972565 |
| Molecular Formula | C20H26ClN4OS+ |
| Molecular Weight | 405.98 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (6-chloro-1-propylbenzimidazol-2-yl)methyl-formyl-(2-methylpropyl)-(2-methyl-1,3-thiazol-4-yl)azanium |
| SMILES | CCCn1c(C[N+](C=O)(CC(C)C)c2csc(C)n2)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H26ClN4OS/c1-5-8-24-18-9-16(21)6-7-17(18)23-19(24)11-25(13-26,10-14(2)3)20-12-27-15(4)22-20/h6-7,9,12-14H,5,8,10-11H2,1-4H3/q+1 |
| InChIKey | INXQEVAPJOFBBK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.98 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|