C14H8ClF3N2O — CID 115473390
3-(6-chloro-1-methylbenzimidazol-2-yl)-2,5,6-trifluorophenol (PubChem CID 115473390) has the molecular formula C14H8ClF3N2O and a molecular weight of 312.68 g/mol. Its IUPAC name is 3-(6-chloro-1-methylbenzimidazol-2-yl)-2,5,6-trifluorophenol.
| Compound Name | 3-(6-chloro-1-methylbenzimidazol-2-yl)-2,5,6-trifluorophenol |
|---|---|
| PubChem CID | 115473390 |
| Molecular Formula | C14H8ClF3N2O |
| Molecular Weight | 312.68 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 3-(6-chloro-1-methylbenzimidazol-2-yl)-2,5,6-trifluorophenol |
| SMILES | Cn1c(-c2cc(F)c(F)c(O)c2F)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H8ClF3N2O/c1-20-10-4-6(15)2-3-9(10)19-14(20)7-5-8(16)12(18)13(21)11(7)17/h2-5,21H,1H3 |
| InChIKey | CDPCNLRVYXKUKE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|