C25H42O9 — CID 11547615
[(1S,3R,4R,6R,7R,8S,9R,10R,13R,14R,16R)-3,4,6,7,9,14-hexahydroxy-5,5,9,14-tetramethyl-16-tetracyclo[11.2.1.01,10.04,8]hexadecanyl] (2S,3S)-3-hydroxy-2-methylbutanoate (PubChem CID 11547615) has the molecular formula C25H42O9 and a molecular weight of 486.60 g/mol. Its IUPAC name is [(1S,3R,4R,6R,7R,8S,9R,10R,13R,14R,16R)-3,4,6,7,9,14-hexahydroxy-5,5,9,14-tetramethyl-16-tetracyclo[11.2.1.01,10.04,8]hexadecanyl] (2S,3S)-3-hydroxy-2-methylbutanoate.
| Compound Name | [(1S,3R,4R,6R,7R,8S,9R,10R,13R,14R,16R)-3,4,6,7,9,14-hexahydroxy-5,5,9,14-tetramethyl-16-tetracyclo[11.2.1.01,10.04,8]hexadecanyl] (2S,3S)-3-hydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 11547615 |
| Molecular Formula | C25H42O9 |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [(1S,3R,4R,6R,7R,8S,9R,10R,13R,14R,16R)-3,4,6,7,9,14-hexahydroxy-5,5,9,14-tetramethyl-16-tetracyclo[11.2.1.01,10.04,8]hexadecanyl] (2S,3S)-3-hydroxy-2-methylbutanoate |
| SMILES | C[C@H](O)[C@H](C)C(=O)O[C@@H]1[C@H]2CC[C@H]3[C@@](C)(O)[C@@H]4[C@@H](O)[C@H](O)C(C)(C)[C@@]4(O)[C@H](O)C[C@@]13C[C@@]2(C)O |
| InChI | InChI=1S/C25H42O9/c1-11(12(2)26)20(30)34-19-13-7-8-14-23(6,32)17-16(28)18(29)21(3,4)25(17,33)15(27)9-24(14,19)10-22(13,5)31/h11-19,26-29,31-33H,7-10H2,1-6H3/t11-,12-,13+,14-,15+,16+,17-,18-,19+,22+,23+,24-,25+/m0/s1 |
| InChIKey | YKGHWWGUARTVTE-GWYMWGSYSA-N |
| XLogP | -0.29 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |