C25H40O8 — CID 74399786
(3,4,10,15-tetrahydroxy-5,5,10,15-tetramethyl-7-oxapentacyclo[12.2.1.01,11.04,9.06,8]heptadecan-17-yl) 3-hydroxy-2-methylbutanoate (PubChem CID 74399786) has the molecular formula C25H40O8 and a molecular weight of 468.59 g/mol. Its IUPAC name is (3,4,10,15-tetrahydroxy-5,5,10,15-tetramethyl-7-oxapentacyclo[12.2.1.01,11.04,9.06,8]heptadecan-17-yl) 3-hydroxy-2-methylbutanoate.
| Compound Name | (3,4,10,15-tetrahydroxy-5,5,10,15-tetramethyl-7-oxapentacyclo[12.2.1.01,11.04,9.06,8]heptadecan-17-yl) 3-hydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 74399786 |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (3,4,10,15-tetrahydroxy-5,5,10,15-tetramethyl-7-oxapentacyclo[12.2.1.01,11.04,9.06,8]heptadecan-17-yl) 3-hydroxy-2-methylbutanoate |
| SMILES | CC(O)C(C)C(=O)OC1C2CCC3C(C)(O)C4C5OC5C(C)(C)C4(O)C(O)CC13CC2(C)O |
| InChI | InChI=1S/C25H40O8/c1-11(12(2)26)20(28)33-18-13-7-8-14-23(6,30)17-16-19(32-16)21(3,4)25(17,31)15(27)9-24(14,18)10-22(13,5)29/h11-19,26-27,29-31H,7-10H2,1-6H3 |
| InChIKey | IJNCLRKOVHEQGU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|