C13H13F3O4S — CID 115478001
5-[[3-(trifluoromethyl)phenyl]sulfinylmethyl]oxolane-2-carboxylic acid (PubChem CID 115478001) has the molecular formula C13H13F3O4S and a molecular weight of 322.30 g/mol. Its IUPAC name is 5-[[3-(trifluoromethyl)phenyl]sulfinylmethyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[[3-(trifluoromethyl)phenyl]sulfinylmethyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 115478001 |
| Molecular Formula | C13H13F3O4S |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 5-[[3-(trifluoromethyl)phenyl]sulfinylmethyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(CS(=O)c2cccc(C(F)(F)F)c2)O1 |
| InChI | InChI=1S/C13H13F3O4S/c14-13(15,16)8-2-1-3-10(6-8)21(19)7-9-4-5-11(20-9)12(17)18/h1-3,6,9,11H,4-5,7H2,(H,17,18) |
| InChIKey | DVMPSZXBTHWVBY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |