C14H19NO4S — CID 115478576
N,7-diethyl-6,6-dioxo-2,3,7,8-tetrahydrothieno[2,3-g][1,4]benzodioxin-8-amine (PubChem CID 115478576) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is N,7-diethyl-6,6-dioxo-2,3,7,8-tetrahydrothieno[2,3-g][1,4]benzodioxin-8-amine.
| Compound Name | N,7-diethyl-6,6-dioxo-2,3,7,8-tetrahydrothieno[2,3-g][1,4]benzodioxin-8-amine |
|---|---|
| PubChem CID | 115478576 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N,7-diethyl-6,6-dioxo-2,3,7,8-tetrahydrothieno[2,3-g][1,4]benzodioxin-8-amine |
| SMILES | CCNC1c2cc3c(cc2S(=O)(=O)C1CC)OCCO3 |
| InChI | InChI=1S/C14H19NO4S/c1-3-12-14(15-4-2)9-7-10-11(19-6-5-18-10)8-13(9)20(12,16)17/h7-8,12,14-15H,3-6H2,1-2H3 |
| InChIKey | VHHKZHKDUOJHTQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |