About Bethanechol Chloride
Bethanechol Chloride (PubChem CID 11548) has the molecular formula C7H17ClN2O2
and a molecular weight of 196.67 g/mol. Its IUPAC name is 2-carbamoyloxypropyl(trimethyl)azanium chloride.
Molecular Properties
| Compound Name | Bethanechol Chloride |
| PubChem CID | 11548 |
| Molecular Formula | C7H17ClN2O2 |
| Molecular Weight | 196.67 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-carbamoyloxypropyl(trimethyl)azanium chloride |
| SMILES | CC(C[N+](C)(C)C)OC(=O)N.[Cl-] |
| InChI | InChI=1S/C7H16N2O2.ClH/c1-6(11-7(8)10)5-9(2,3)4;/h6H,5H2,1-4H3,(H-,8,10);1H |
| InChIKey | XXRMYXBSBOVVBH-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | 140 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze Bethanechol Chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Bethanechol Chloride?
The IUPAC name of Bethanechol Chloride (CID 11548) is 2-carbamoyloxypropyl(trimethyl)azanium chloride.
What is the SMILES notation for Bethanechol Chloride?
The canonical SMILES for Bethanechol Chloride is CC(C[N+](C)(C)C)OC(=O)N.[Cl-].
What is the InChIKey of Bethanechol Chloride?
The InChIKey is XXRMYXBSBOVVBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2.ClH/c1-6(11-7(8)10)5-9(2,3)4;/h6H,5H2,1-4H3,(H-,8,10);1H.
What are the key properties of Bethanechol Chloride?
Bethanechol Chloride has a molecular weight of 196.67 g/mol, XLogP of not available, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Bethanechol Chloride is sourced from PubChem (CID 11548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).