C30H45NO4Si — CID 11548010
(4S)-4-benzyl-3-[(2S,3R,5S)-3-hydroxy-5-methyl-2-prop-2-enyl-7-tri(propan-2-yl)silylhept-6-ynoyl]-1,3-oxazolidin-2-one (PubChem CID 11548010) has the molecular formula C30H45NO4Si and a molecular weight of 511.78 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3R,5S)-3-hydroxy-5-methyl-2-prop-2-enyl-7-tri(propan-2-yl)silylhept-6-ynoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3R,5S)-3-hydroxy-5-methyl-2-prop-2-enyl-7-tri(propan-2-yl)silylhept-6-ynoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11548010 |
| Molecular Formula | C30H45NO4Si |
| Molecular Weight | 511.78 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3R,5S)-3-hydroxy-5-methyl-2-prop-2-enyl-7-tri(propan-2-yl)silylhept-6-ynoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@H](O)C[C@H](C)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H45NO4Si/c1-9-13-27(28(32)18-24(8)16-17-36(21(2)3,22(4)5)23(6)7)29(33)31-26(20-35-30(31)34)19-25-14-11-10-12-15-25/h9-12,14-15,21-24,26-28,32H,1,13,18-20H2,2-8H3/t24-,26+,27+,28-/m1/s1 |
| InChIKey | JGRUEOJRCRISAI-CPKBAGSISA-N |
| XLogP | 6.38 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.78 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|