C9H12O4 — CID 115480787
1-(furan-3-yl)-3,3-dimethoxypropan-1-one (PubChem CID 115480787) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-(furan-3-yl)-3,3-dimethoxypropan-1-one.
| Compound Name | 1-(furan-3-yl)-3,3-dimethoxypropan-1-one |
|---|---|
| PubChem CID | 115480787 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-(furan-3-yl)-3,3-dimethoxypropan-1-one |
| SMILES | COC(CC(=O)c1ccoc1)OC |
| InChI | InChI=1S/C9H12O4/c1-11-9(12-2)5-8(10)7-3-4-13-6-7/h3-4,6,9H,5H2,1-2H3 |
| InChIKey | XKQGCZMGIBITPI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|