C18H29N — CID 115482007
2-cyclohexyl-1-(3,4-diethylphenyl)ethanamine (PubChem CID 115482007) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 2-cyclohexyl-1-(3,4-diethylphenyl)ethanamine.
| Compound Name | 2-cyclohexyl-1-(3,4-diethylphenyl)ethanamine |
|---|---|
| PubChem CID | 115482007 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 2-cyclohexyl-1-(3,4-diethylphenyl)ethanamine |
| SMILES | CCc1ccc(C(N)CC2CCCCC2)cc1CC |
| InChI | InChI=1S/C18H29N/c1-3-15-10-11-17(13-16(15)4-2)18(19)12-14-8-6-5-7-9-14/h10-11,13-14,18H,3-9,12,19H2,1-2H3 |
| InChIKey | GIBKNNSQVYBNJF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |