C15H23N — CID 115847413
2-cyclopentyl-1-(2-ethylphenyl)ethanamine (PubChem CID 115847413) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 2-cyclopentyl-1-(2-ethylphenyl)ethanamine.
| Compound Name | 2-cyclopentyl-1-(2-ethylphenyl)ethanamine |
|---|---|
| PubChem CID | 115847413 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2-cyclopentyl-1-(2-ethylphenyl)ethanamine |
| SMILES | CCc1ccccc1C(N)CC1CCCC1 |
| InChI | InChI=1S/C15H23N/c1-2-13-9-5-6-10-14(13)15(16)11-12-7-3-4-8-12/h5-6,9-10,12,15H,2-4,7-8,11,16H2,1H3 |
| InChIKey | PODSJAHROHXTIK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |