C33H49N3O3 — CID 11548330
(2S)-N-[(E,3S,6R)-6-hydroxy-2,5-dimethyl-6-phenylhex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide (PubChem CID 11548330) has the molecular formula C33H49N3O3 and a molecular weight of 535.77 g/mol. Its IUPAC name is (2S)-N-[(E,3S,6R)-6-hydroxy-2,5-dimethyl-6-phenylhex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide.
| Compound Name | (2S)-N-[(E,3S,6R)-6-hydroxy-2,5-dimethyl-6-phenylhex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide |
|---|---|
| PubChem CID | 11548330 |
| Molecular Formula | C33H49N3O3 |
| Molecular Weight | 535.77 g/mol |
| Exact Mass | 535.38 |
| IUPAC Name | (2S)-N-[(E,3S,6R)-6-hydroxy-2,5-dimethyl-6-phenylhex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide |
| SMILES | CN[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](/C=C(\C)[C@@H](O)c1ccccc1)C(C)C)C(C)(C)C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C33H49N3O3/c1-22(2)26(21-23(3)27(37)24-17-13-11-14-18-24)36(10)31(39)29(32(4,5)6)35-30(38)28(34-9)33(7,8)25-19-15-12-16-20-25/h11-22,26-29,34,37H,1-10H3,(H,35,38)/b23-21+/t26-,27-,28-,29-/m1/s1 |
| InChIKey | HTOZTDPNNYZTSI-XDZOPTLVSA-N |
| XLogP | 5.25 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.77 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|