C13H18ClN — CID 115483752
(2-chloro-4,5-dimethylphenyl)-cyclobutylmethanamine (PubChem CID 115483752) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is (2-chloro-4,5-dimethylphenyl)-cyclobutylmethanamine.
| Compound Name | (2-chloro-4,5-dimethylphenyl)-cyclobutylmethanamine |
|---|---|
| PubChem CID | 115483752 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2-chloro-4,5-dimethylphenyl)-cyclobutylmethanamine |
| SMILES | Cc1cc(Cl)c(C(N)C2CCC2)cc1C |
| InChI | InChI=1S/C13H18ClN/c1-8-6-11(12(14)7-9(8)2)13(15)10-4-3-5-10/h6-7,10,13H,3-5,15H2,1-2H3 |
| InChIKey | WABYCYPNGOWASJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |